C22H23N3O2 — CID 142958172
ethane;3-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]-5-nitro-1H-indazole (PubChem CID 142958172) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is ethane;3-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]-5-nitro-1H-indazole.
| Compound Name | ethane;3-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]-5-nitro-1H-indazole |
|---|---|
| PubChem CID | 142958172 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | ethane;3-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]phenyl]-5-nitro-1H-indazole |
| SMILES | C=C/C=C\C=C(/C)c1cccc(-c2n[nH]c3ccc([N+](=O)[O-])cc23)c1.CC |
| InChI | InChI=1S/C20H17N3O2.C2H6/c1-3-4-5-7-14(2)15-8-6-9-16(12-15)20-18-13-17(23(24)25)10-11-19(18)21-22-20;1-2/h3-13H,1H2,2H3,(H,21,22);1-2H3/b5-4-,14-7+; |
| InChIKey | VKDBNYRGVZFHFX-QFFZGADHSA-N |
| XLogP | 6.31 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|