C15H10N6O3 — CID 75392689
N-(5-nitro-1H-indazol-3-yl)-3H-benzimidazole-5-carboxamide (PubChem CID 75392689) has the molecular formula C15H10N6O3 and a molecular weight of 322.28 g/mol. Its IUPAC name is N-(5-nitro-1H-indazol-3-yl)-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(5-nitro-1H-indazol-3-yl)-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 75392689 |
| Molecular Formula | C15H10N6O3 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-(5-nitro-1H-indazol-3-yl)-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(Nc1n[nH]c2ccc([N+](=O)[O-])cc12)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C15H10N6O3/c22-15(8-1-3-12-13(5-8)17-7-16-12)18-14-10-6-9(21(23)24)2-4-11(10)19-20-14/h1-7H,(H,16,17)(H2,18,19,20,22) |
| InChIKey | RAMPKUCBUWTFHR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|