C22H18N6O5 — CID 99792834
3-[[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]amino]-N-(5-nitro-1H-indazol-3-yl)benzamide (PubChem CID 99792834) has the molecular formula C22H18N6O5 and a molecular weight of 446.42 g/mol. Its IUPAC name is 3-[[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]amino]-N-(5-nitro-1H-indazol-3-yl)benzamide.
| Compound Name | 3-[[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]amino]-N-(5-nitro-1H-indazol-3-yl)benzamide |
|---|---|
| PubChem CID | 99792834 |
| Molecular Formula | C22H18N6O5 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 3-[[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]amino]-N-(5-nitro-1H-indazol-3-yl)benzamide |
| SMILES | O=C(Nc1n[nH]c2ccc([N+](=O)[O-])cc12)c1cccc(NN2C(=O)[C@H]3CC=CC[C@H]3C2=O)c1 |
| InChI | InChI=1S/C22H18N6O5/c29-20(23-19-17-11-14(28(32)33)8-9-18(17)24-25-19)12-4-3-5-13(10-12)26-27-21(30)15-6-1-2-7-16(15)22(27)31/h1-5,8-11,15-16,26H,6-7H2,(H2,23,24,25,29)/t15-,16+ |
| InChIKey | TYWFVVUIZQZVHS-IYBDPMFKSA-N |
| XLogP | 3.00 |
| TPSA | 150.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|