C20H15N5O4S — CID 122584500
3-[(3-nitrobenzoyl)amino]-N-(thiophen-2-ylmethyl)-1H-indazole-5-carboxamide (PubChem CID 122584500) has the molecular formula C20H15N5O4S and a molecular weight of 421.44 g/mol. Its IUPAC name is 3-[(3-nitrobenzoyl)amino]-N-(thiophen-2-ylmethyl)-1H-indazole-5-carboxamide.
| Compound Name | 3-[(3-nitrobenzoyl)amino]-N-(thiophen-2-ylmethyl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 122584500 |
| Molecular Formula | C20H15N5O4S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 3-[(3-nitrobenzoyl)amino]-N-(thiophen-2-ylmethyl)-1H-indazole-5-carboxamide |
| SMILES | O=C(NCc1cccs1)c1ccc2[nH]nc(NC(=O)c3cccc([N+](=O)[O-])c3)c2c1 |
| InChI | InChI=1S/C20H15N5O4S/c26-19(21-11-15-5-2-8-30-15)13-6-7-17-16(10-13)18(24-23-17)22-20(27)12-3-1-4-14(9-12)25(28)29/h1-10H,11H2,(H,21,26)(H2,22,23,24,27) |
| InChIKey | XAZYHZBACGIWDW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|