C15H10N4O4 — CID 3937825
3-nitro-N-(4-oxo-1H-cinnolin-3-yl)benzamide (PubChem CID 3937825) has the molecular formula C15H10N4O4 and a molecular weight of 310.27 g/mol. Its IUPAC name is 3-nitro-N-(4-oxo-1H-cinnolin-3-yl)benzamide.
| Compound Name | 3-nitro-N-(4-oxo-1H-cinnolin-3-yl)benzamide |
|---|---|
| PubChem CID | 3937825 |
| Molecular Formula | C15H10N4O4 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-nitro-N-(4-oxo-1H-cinnolin-3-yl)benzamide |
| SMILES | O=C(Nc1n[nH]c2ccccc2c1=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10N4O4/c20-13-11-6-1-2-7-12(11)17-18-14(13)16-15(21)9-4-3-5-10(8-9)19(22)23/h1-8H,(H,17,20)(H,16,18,21) |
| InChIKey | FPQPQXAFDFVGHJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|