C16H14N6O5 — CID 57385641
ethyl 6-amino-3-[(3-nitrobenzoyl)amino]-1H-pyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 57385641) has the molecular formula C16H14N6O5 and a molecular weight of 370.33 g/mol. Its IUPAC name is ethyl 6-amino-3-[(3-nitrobenzoyl)amino]-1H-pyrazolo[3,4-b]pyridine-5-carboxylate.
| Compound Name | ethyl 6-amino-3-[(3-nitrobenzoyl)amino]-1H-pyrazolo[3,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 57385641 |
| Molecular Formula | C16H14N6O5 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | ethyl 6-amino-3-[(3-nitrobenzoyl)amino]-1H-pyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(NC(=O)c3cccc([N+](=O)[O-])c3)n[nH]c2nc1N |
| InChI | InChI=1S/C16H14N6O5/c1-2-27-16(24)10-7-11-13(18-12(10)17)20-21-14(11)19-15(23)8-4-3-5-9(6-8)22(25)26/h3-7H,2H2,1H3,(H4,17,18,19,20,21,23) |
| InChIKey | OHUXZFLXMKCVMH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 166.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|