C20H24N6O4 — CID 163656820
3-(dimethylamino)propyl 6-amino-3-[(4-methoxybenzoyl)amino]-1H-pyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 163656820) has the molecular formula C20H24N6O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 6-amino-3-[(4-methoxybenzoyl)amino]-1H-pyrazolo[3,4-b]pyridine-5-carboxylate.
| Compound Name | 3-(dimethylamino)propyl 6-amino-3-[(4-methoxybenzoyl)amino]-1H-pyrazolo[3,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 163656820 |
| Molecular Formula | C20H24N6O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 3-(dimethylamino)propyl 6-amino-3-[(4-methoxybenzoyl)amino]-1H-pyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | COc1ccc(C(=O)Nc2n[nH]c3nc(N)c(C(=O)OCCCN(C)C)cc23)cc1 |
| InChI | InChI=1S/C20H24N6O4/c1-26(2)9-4-10-30-20(28)14-11-15-17(22-16(14)21)24-25-18(15)23-19(27)12-5-7-13(29-3)8-6-12/h5-8,11H,4,9-10H2,1-3H3,(H4,21,22,23,24,25,27) |
| InChIKey | IQYALMCEPHCMFN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|