C18H18N4O6 — CID 24539895
N'-[(2S)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoyl]-3-nitrobenzohydrazide (PubChem CID 24539895) has the molecular formula C18H18N4O6 and a molecular weight of 386.36 g/mol. Its IUPAC name is N'-[(2S)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[(2S)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 24539895 |
| Molecular Formula | C18H18N4O6 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N'-[(2S)-2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanoyl]-3-nitrobenzohydrazide |
| SMILES | C[C@@H](C(=O)NNC(=O)c1cccc([N+](=O)[O-])c1)N1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C18H18N4O6/c1-10(21-17(25)13-7-2-3-8-14(13)18(21)26)15(23)19-20-16(24)11-5-4-6-12(9-11)22(27)28/h2-6,9-10,13-14H,7-8H2,1H3,(H,19,23)(H,20,24)/t10-,13?,14?/m0/s1 |
| InChIKey | DCNXMIWVHMFDSO-FNBIGBAISA-N |
| XLogP | 0.70 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|