About silver 6-nitro-1H-benzimidazole
silver 6-nitro-1H-benzimidazole (PubChem CID 19981768) has the molecular formula C7H5AgN3O2+
and a molecular weight of 271.00 g/mol. Its IUPAC name is silver 6-nitro-1H-benzimidazole.
Molecular Properties
| Compound Name | silver 6-nitro-1H-benzimidazole |
| PubChem CID | 19981768 |
| Molecular Formula | C7H5AgN3O2+ |
| Molecular Weight | 271.00 g/mol |
| Exact Mass | 269.94 |
| IUPAC Name | silver 6-nitro-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ccc2nc[nH]c2c1.[Ag+] |
| InChI | InChI=1S/C7H5N3O2.Ag/c11-10(12)5-1-2-6-7(3-5)9-4-8-6;/h1-4H,(H,8,9);/q;+1 |
| InChIKey | PFBUGRDWKUDGBC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.00 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze silver 6-nitro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver 6-nitro-1H-benzimidazole?
The IUPAC name of silver 6-nitro-1H-benzimidazole (CID 19981768) is silver 6-nitro-1H-benzimidazole.
What is the SMILES notation for silver 6-nitro-1H-benzimidazole?
The canonical SMILES for silver 6-nitro-1H-benzimidazole is O=[N+]([O-])c1ccc2nc[nH]c2c1.[Ag+].
What is the InChIKey of silver 6-nitro-1H-benzimidazole?
The InChIKey is PFBUGRDWKUDGBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2.Ag/c11-10(12)5-1-2-6-7(3-5)9-4-8-6;/h1-4H,(H,8,9);/q;+1.
What are the key properties of silver 6-nitro-1H-benzimidazole?
silver 6-nitro-1H-benzimidazole has a molecular weight of 271.00 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for silver 6-nitro-1H-benzimidazole is sourced from PubChem (CID 19981768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).