About 6-methyl-1H-benzimidazole;2-nitro-1H-imidazole
6-methyl-1H-benzimidazole;2-nitro-1H-imidazole (PubChem CID 159525910) has the molecular formula C11H11N5O2
and a molecular weight of 245.24 g/mol. Its IUPAC name is 6-methyl-1H-benzimidazole;2-nitro-1H-imidazole.
Molecular Properties
| Compound Name | 6-methyl-1H-benzimidazole;2-nitro-1H-imidazole |
| PubChem CID | 159525910 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 6-methyl-1H-benzimidazole;2-nitro-1H-imidazole |
| SMILES | Cc1ccc2nc[nH]c2c1.O=[N+]([O-])c1ncc[nH]1 |
| InChI | InChI=1S/C8H8N2.C3H3N3O2/c1-6-2-3-7-8(4-6)10-5-9-7;7-6(8)3-4-1-2-5-3/h2-5H,1H3,(H,9,10);1-2H,(H,4,5) |
| InChIKey | MCJNYQHCFMYNST-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-1H-benzimidazole;2-nitro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1H-benzimidazole;2-nitro-1H-imidazole?
The IUPAC name of 6-methyl-1H-benzimidazole;2-nitro-1H-imidazole (CID 159525910) is 6-methyl-1H-benzimidazole;2-nitro-1H-imidazole.
What is the SMILES notation for 6-methyl-1H-benzimidazole;2-nitro-1H-imidazole?
The canonical SMILES for 6-methyl-1H-benzimidazole;2-nitro-1H-imidazole is Cc1ccc2nc[nH]c2c1.O=[N+]([O-])c1ncc[nH]1.
What is the InChIKey of 6-methyl-1H-benzimidazole;2-nitro-1H-imidazole?
The InChIKey is MCJNYQHCFMYNST-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C3H3N3O2/c1-6-2-3-7-8(4-6)10-5-9-7;7-6(8)3-4-1-2-5-3/h2-5H,1H3,(H,9,10);1-2H,(H,4,5).
What are the key properties of 6-methyl-1H-benzimidazole;2-nitro-1H-imidazole?
6-methyl-1H-benzimidazole;2-nitro-1H-imidazole has a molecular weight of 245.24 g/mol, XLogP of 2.19, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1H-benzimidazole;2-nitro-1H-imidazole is sourced from PubChem (CID 159525910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).