About CID 59909636
CID 59909636 (PubChem CID 59909636) has the molecular formula C8H6N2
and a molecular weight of 130.15 g/mol.
Molecular Properties
| Compound Name | CID 59909636 |
| PubChem CID | 59909636 |
| Molecular Formula | C8H6N2 |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | — |
| SMILES | [CH]c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C8H6N2/c1-6-2-3-7-8(4-6)10-5-9-7/h1-5H,(H,9,10) |
| InChIKey | MUKMNIDXQZYTKI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 59909636 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59909636?
The IUPAC name of CID 59909636 (CID 59909636) is not available.
What is the SMILES notation for CID 59909636?
The canonical SMILES for CID 59909636 is [CH]c1ccc2nc[nH]c2c1.
What is the InChIKey of CID 59909636?
The InChIKey is MUKMNIDXQZYTKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2/c1-6-2-3-7-8(4-6)10-5-9-7/h1-5H,(H,9,10).
What are the key properties of CID 59909636?
CID 59909636 has a molecular weight of 130.15 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59909636 is sourced from PubChem (CID 59909636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).