About 3H-benzimidazol-5-yl-dimethyl-sulfanyl-λ4-sulfane
3H-benzimidazol-5-yl-dimethyl-sulfanyl-λ4-sulfane (PubChem CID 91169842) has the molecular formula C9H12N2S2
and a molecular weight of 212.34 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-dimethyl-sulfanyl-λ4-sulfane.
Molecular Properties
| Compound Name | 3H-benzimidazol-5-yl-dimethyl-sulfanyl-λ4-sulfane |
| PubChem CID | 91169842 |
| Molecular Formula | C9H12N2S2 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 3H-benzimidazol-5-yl-dimethyl-sulfanyl-λ4-sulfane |
| SMILES | CS(C)(S)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C9H12N2S2/c1-13(2,12)7-3-4-8-9(5-7)11-6-10-8/h3-6,12H,1-2H3,(H,10,11) |
| InChIKey | RHTQTVPFLQBWMF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3H-benzimidazol-5-yl-dimethyl-sulfanyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-benzimidazol-5-yl-dimethyl-sulfanyl-λ4-sulfane?
The IUPAC name of 3H-benzimidazol-5-yl-dimethyl-sulfanyl-λ4-sulfane (CID 91169842) is 3H-benzimidazol-5-yl-dimethyl-sulfanyl-λ4-sulfane.
What is the SMILES notation for 3H-benzimidazol-5-yl-dimethyl-sulfanyl-λ4-sulfane?
The canonical SMILES for 3H-benzimidazol-5-yl-dimethyl-sulfanyl-λ4-sulfane is CS(C)(S)c1ccc2nc[nH]c2c1.
What is the InChIKey of 3H-benzimidazol-5-yl-dimethyl-sulfanyl-λ4-sulfane?
The InChIKey is RHTQTVPFLQBWMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2S2/c1-13(2,12)7-3-4-8-9(5-7)11-6-10-8/h3-6,12H,1-2H3,(H,10,11).
What are the key properties of 3H-benzimidazol-5-yl-dimethyl-sulfanyl-λ4-sulfane?
3H-benzimidazol-5-yl-dimethyl-sulfanyl-λ4-sulfane has a molecular weight of 212.34 g/mol, XLogP of 2.83, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-benzimidazol-5-yl-dimethyl-sulfanyl-λ4-sulfane is sourced from PubChem (CID 91169842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).