About potassium;6-nitro-1H-benzimidazole;bromide
potassium;6-nitro-1H-benzimidazole;bromide (PubChem CID 159548284) has the molecular formula C7H5BrKN3O2
and a molecular weight of 282.14 g/mol. Its IUPAC name is potassium;6-nitro-1H-benzimidazole;bromide.
Molecular Properties
| Compound Name | potassium;6-nitro-1H-benzimidazole;bromide |
| PubChem CID | 159548284 |
| Molecular Formula | C7H5BrKN3O2 |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 280.92 |
| IUPAC Name | potassium;6-nitro-1H-benzimidazole;bromide |
| SMILES | O=[N+]([O-])c1ccc2nc[nH]c2c1.[Br-].[K+] |
| InChI | InChI=1S/C7H5N3O2.BrH.K/c11-10(12)5-1-2-6-7(3-5)9-4-8-6;;/h1-4H,(H,8,9);1H;/q;;+1/p-1 |
| InChIKey | MFBMXGXUZVGDGD-UHFFFAOYSA-M |
| XLogP | -4.52 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | -4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium;6-nitro-1H-benzimidazole;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;6-nitro-1H-benzimidazole;bromide?
The IUPAC name of potassium;6-nitro-1H-benzimidazole;bromide (CID 159548284) is potassium;6-nitro-1H-benzimidazole;bromide.
What is the SMILES notation for potassium;6-nitro-1H-benzimidazole;bromide?
The canonical SMILES for potassium;6-nitro-1H-benzimidazole;bromide is O=[N+]([O-])c1ccc2nc[nH]c2c1.[Br-].[K+].
What is the InChIKey of potassium;6-nitro-1H-benzimidazole;bromide?
The InChIKey is MFBMXGXUZVGDGD-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5N3O2.BrH.K/c11-10(12)5-1-2-6-7(3-5)9-4-8-6;;/h1-4H,(H,8,9);1H;/q;;+1/p-1.
What are the key properties of potassium;6-nitro-1H-benzimidazole;bromide?
potassium;6-nitro-1H-benzimidazole;bromide has a molecular weight of 282.14 g/mol, XLogP of -4.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;6-nitro-1H-benzimidazole;bromide is sourced from PubChem (CID 159548284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).