About 6-nitro-1H-benzimidazole;sulfuric acid
6-nitro-1H-benzimidazole;sulfuric acid (PubChem CID 44725885) has the molecular formula C7H7N3O6S
and a molecular weight of 261.21 g/mol. Its IUPAC name is 6-nitro-1H-benzimidazole;sulfuric acid.
Molecular Properties
| Compound Name | 6-nitro-1H-benzimidazole;sulfuric acid |
| PubChem CID | 44725885 |
| Molecular Formula | C7H7N3O6S |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 6-nitro-1H-benzimidazole;sulfuric acid |
| SMILES | O=S(=O)(O)O.O=[N+]([O-])c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C7H5N3O2.H2O4S/c11-10(12)5-1-2-6-7(3-5)9-4-8-6;1-5(2,3)4/h1-4H,(H,8,9);(H2,1,2,3,4) |
| InChIKey | SMYIQNDUTRSHFM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 146.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 6-nitro-1H-benzimidazole;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitro-1H-benzimidazole;sulfuric acid?
The IUPAC name of 6-nitro-1H-benzimidazole;sulfuric acid (CID 44725885) is 6-nitro-1H-benzimidazole;sulfuric acid.
What is the SMILES notation for 6-nitro-1H-benzimidazole;sulfuric acid?
The canonical SMILES for 6-nitro-1H-benzimidazole;sulfuric acid is O=S(=O)(O)O.O=[N+]([O-])c1ccc2nc[nH]c2c1.
What is the InChIKey of 6-nitro-1H-benzimidazole;sulfuric acid?
The InChIKey is SMYIQNDUTRSHFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2.H2O4S/c11-10(12)5-1-2-6-7(3-5)9-4-8-6;1-5(2,3)4/h1-4H,(H,8,9);(H2,1,2,3,4).
What are the key properties of 6-nitro-1H-benzimidazole;sulfuric acid?
6-nitro-1H-benzimidazole;sulfuric acid has a molecular weight of 261.21 g/mol, XLogP of 0.82, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-1H-benzimidazole;sulfuric acid is sourced from PubChem (CID 44725885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).