C39H28N6 — CID 163432923
12-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]-11-pyridin-2-ylindolo[2,3-a]carbazole (PubChem CID 163432923) has the molecular formula C39H28N6 and a molecular weight of 580.70 g/mol. Its IUPAC name is 12-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]-11-pyridin-2-ylindolo[2,3-a]carbazole.
| Compound Name | 12-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]-11-pyridin-2-ylindolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 163432923 |
| Molecular Formula | C39H28N6 |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | 12-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]-11-pyridin-2-ylindolo[2,3-a]carbazole |
| SMILES | C=C/C=C\C=C(/C)c1nc(-c2ccccc2)nc(-n2c3ccccc3c3ccc4c5ccccc5n(-c5ccccn5)c4c32)n1 |
| InChI | InChI=1S/C39H28N6/c1-3-4-6-15-26(2)37-41-38(27-16-7-5-8-17-27)43-39(42-37)45-33-21-12-10-19-29(33)31-24-23-30-28-18-9-11-20-32(28)44(35(30)36(31)45)34-22-13-14-25-40-34/h3-25H,1H2,2H3/b6-4-,26-15+ |
| InChIKey | ASAUSCJUMLKVIO-KDNZLOOTSA-N |
| XLogP | 9.27 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|