C52H35N5S — CID 139496978
5-[1-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophen-2-yl]-12-phenylindolo[3,2-c]carbazole (PubChem CID 139496978) has the molecular formula C52H35N5S and a molecular weight of 761.95 g/mol. Its IUPAC name is 5-[1-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophen-2-yl]-12-phenylindolo[3,2-c]carbazole.
| Compound Name | 5-[1-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophen-2-yl]-12-phenylindolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 139496978 |
| Molecular Formula | C52H35N5S |
| Molecular Weight | 761.95 g/mol |
| Exact Mass | 761.26 |
| IUPAC Name | 5-[1-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]dibenzothiophen-2-yl]-12-phenylindolo[3,2-c]carbazole |
| SMILES | C=C/C=C\C=C(/C)c1nc(-c2ccccc2)nc(-c2c(-n3c4ccccc4c4c3ccc3c5ccccc5n(-c5ccccc5)c34)ccc3sc4ccccc4c23)n1 |
| InChI | InChI=1S/C52H35N5S/c1-3-4-7-18-33(2)50-53-51(34-19-8-5-9-20-34)55-52(54-50)48-43(31-32-45-47(48)39-25-14-17-28-44(39)58-45)57-41-27-16-13-24-38(41)46-42(57)30-29-37-36-23-12-15-26-40(36)56(49(37)46)35-21-10-6-11-22-35/h3-32H,1H2,2H3/b7-4-,33-18+ |
| InChIKey | ULIBXYHYNSFUSC-VFZVJXRYSA-N |
| XLogP | 13.91 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.95 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|