C42H33N5 — CID 88946936
4-[4-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-13,13-dimethyl-1,18-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene (PubChem CID 88946936) has the molecular formula C42H33N5 and a molecular weight of 607.76 g/mol. Its IUPAC name is 4-[4-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-13,13-dimethyl-1,18-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene.
| Compound Name | 4-[4-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-13,13-dimethyl-1,18-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 88946936 |
| Molecular Formula | C42H33N5 |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.27 |
| IUPAC Name | 4-[4-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-13,13-dimethyl-1,18-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene |
| SMILES | C=C/C=C\C=C(/C)c1nc(-c2ccccc2)nc(-c2ccc(-c3ccc4c5cccc6c5n(c4c3)-c3ncccc3C6(C)C)cc2)n1 |
| InChI | InChI=1S/C42H33N5/c1-5-6-8-13-27(2)38-44-39(29-14-9-7-10-15-29)46-40(45-38)30-21-19-28(20-22-30)31-23-24-32-33-16-11-17-34-37(33)47(36(32)26-31)41-35(42(34,3)4)18-12-25-43-41/h5-26H,1H2,2-4H3/b8-6-,27-13+ |
| InChIKey | OEIYBARHUBLCBZ-XXVICXCASA-N |
| XLogP | 10.15 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|