C39H28N4 — CID 135245174
3-[4-[2-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]naphthalen-1-yl]phenyl]benzonitrile (PubChem CID 135245174) has the molecular formula C39H28N4 and a molecular weight of 552.68 g/mol. Its IUPAC name is 3-[4-[2-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]naphthalen-1-yl]phenyl]benzonitrile.
| Compound Name | 3-[4-[2-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]naphthalen-1-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 135245174 |
| Molecular Formula | C39H28N4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 3-[4-[2-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazin-2-yl]naphthalen-1-yl]phenyl]benzonitrile |
| SMILES | C=C/C=C\C=C(/C)c1nc(-c2ccccc2)nc(-c2ccc3ccccc3c2-c2ccc(-c3cccc(C#N)c3)cc2)n1 |
| InChI | InChI=1S/C39H28N4/c1-3-4-6-12-27(2)37-41-38(32-15-7-5-8-16-32)43-39(42-37)35-24-23-30-14-9-10-18-34(30)36(35)31-21-19-29(20-22-31)33-17-11-13-28(25-33)26-40/h3-25H,1H2,2H3/b6-4-,27-12+ |
| InChIKey | UQMNAJQKOFGYLS-OIUZTQDDSA-N |
| XLogP | 9.71 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|