C50H37N3 — CID 167135729
2-phenyl-4-(4-phenylphenyl)-6-[(2E,4Z)-6-[2-(4-phenylphenyl)naphthalen-1-yl]hepta-2,4,6-trien-2-yl]-1,3,5-triazine (PubChem CID 167135729) has the molecular formula C50H37N3 and a molecular weight of 679.87 g/mol. Its IUPAC name is 2-phenyl-4-(4-phenylphenyl)-6-[(2E,4Z)-6-[2-(4-phenylphenyl)naphthalen-1-yl]hepta-2,4,6-trien-2-yl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(4-phenylphenyl)-6-[(2E,4Z)-6-[2-(4-phenylphenyl)naphthalen-1-yl]hepta-2,4,6-trien-2-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 167135729 |
| Molecular Formula | C50H37N3 |
| Molecular Weight | 679.87 g/mol |
| Exact Mass | 679.30 |
| IUPAC Name | 2-phenyl-4-(4-phenylphenyl)-6-[(2E,4Z)-6-[2-(4-phenylphenyl)naphthalen-1-yl]hepta-2,4,6-trien-2-yl]-1,3,5-triazine |
| SMILES | C=C(/C=C\C=C(/C)c1nc(-c2ccccc2)nc(-c2ccc(-c3ccccc3)cc2)n1)c1c(-c2ccc(-c3ccccc3)cc2)ccc2ccccc12 |
| InChI | InChI=1S/C50H37N3/c1-35(47-45-24-13-12-21-41(45)33-34-46(47)42-29-25-39(26-30-42)37-17-6-3-7-18-37)15-14-16-36(2)48-51-49(43-22-10-5-11-23-43)53-50(52-48)44-31-27-40(28-32-44)38-19-8-4-9-20-38/h3-34H,1H2,2H3/b15-14-,36-16+ |
| InChIKey | PCDUFTZEXVXSSH-BLNAOOBNSA-N |
| XLogP | 13.03 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.87 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|