C23H20BrN3 — CID 145073108
bromomethane;2-[(2E,4Z)-hepta-2,4-dien-6-yn-2-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 145073108) has the molecular formula C23H20BrN3 and a molecular weight of 418.34 g/mol. Its IUPAC name is bromomethane;2-[(2E,4Z)-hepta-2,4-dien-6-yn-2-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | bromomethane;2-[(2E,4Z)-hepta-2,4-dien-6-yn-2-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 145073108 |
| Molecular Formula | C23H20BrN3 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | bromomethane;2-[(2E,4Z)-hepta-2,4-dien-6-yn-2-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | C#C/C=C\C=C(/C)c1nc(-c2ccccc2)nc(-c2ccccc2)n1.CBr |
| InChI | InChI=1S/C22H17N3.CH3Br/c1-3-4-7-12-17(2)20-23-21(18-13-8-5-9-14-18)25-22(24-20)19-15-10-6-11-16-19;1-2/h1,4-16H,2H3;1H3/b7-4-,17-12+; |
| InChIKey | BGYOXNZKMBDCLC-HBMMBURUSA-N |
| XLogP | 5.81 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|