C21H21N3 — CID 143271767
2-but-1-en-2-yl-4-[(4E,6Z)-octa-4,6-dien-1-yn-4-yl]-6-phenyl-1,3,5-triazine (PubChem CID 143271767) has the molecular formula C21H21N3 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-but-1-en-2-yl-4-[(4E,6Z)-octa-4,6-dien-1-yn-4-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-but-1-en-2-yl-4-[(4E,6Z)-octa-4,6-dien-1-yn-4-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 143271767 |
| Molecular Formula | C21H21N3 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2-but-1-en-2-yl-4-[(4E,6Z)-octa-4,6-dien-1-yn-4-yl]-6-phenyl-1,3,5-triazine |
| SMILES | C#CC/C(=C\C=C/C)c1nc(C(=C)CC)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H21N3/c1-5-8-13-17(12-6-2)20-22-19(16(4)7-3)23-21(24-20)18-14-10-9-11-15-18/h2,5,8-11,13-15H,4,7,12H2,1,3H3/b8-5-,17-13+ |
| InChIKey | ZVLWLMBLXJODCT-KERZFVRCSA-N |
| XLogP | 4.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|