C40H32N4 — CID 126728070
3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-[(3E,5Z)-hepta-3,5-dien-3-yl]carbazole (PubChem CID 126728070) has the molecular formula C40H32N4 and a molecular weight of 568.72 g/mol. Its IUPAC name is 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-[(3E,5Z)-hepta-3,5-dien-3-yl]carbazole.
| Compound Name | 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-[(3E,5Z)-hepta-3,5-dien-3-yl]carbazole |
|---|---|
| PubChem CID | 126728070 |
| Molecular Formula | C40H32N4 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | 3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-[(3E,5Z)-hepta-3,5-dien-3-yl]carbazole |
| SMILES | C/C=C\C=C(/CC)n1c2ccccc2c2cc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)ccc21 |
| InChI | InChI=1S/C40H32N4/c1-3-5-21-33(4-2)44-36-23-13-12-22-34(36)35-27-31(24-25-37(35)44)30-19-14-20-32(26-30)40-42-38(28-15-8-6-9-16-28)41-39(43-40)29-17-10-7-11-18-29/h3,5-27H,4H2,1-2H3/b5-3-,33-21+ |
| InChIKey | UHIQUBSVJVCKDA-YCZREUMVSA-N |
| XLogP | 10.47 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|