C45H33N5 — CID 139297111
8-[4-[4-(4-phenylphenyl)-6-[(2E,4E)-5-quinolin-8-ylhexa-2,4-dien-2-yl]-1,3,5-triazin-2-yl]phenyl]quinoline (PubChem CID 139297111) has the molecular formula C45H33N5 and a molecular weight of 643.79 g/mol. Its IUPAC name is 8-[4-[4-(4-phenylphenyl)-6-[(2E,4E)-5-quinolin-8-ylhexa-2,4-dien-2-yl]-1,3,5-triazin-2-yl]phenyl]quinoline.
| Compound Name | 8-[4-[4-(4-phenylphenyl)-6-[(2E,4E)-5-quinolin-8-ylhexa-2,4-dien-2-yl]-1,3,5-triazin-2-yl]phenyl]quinoline |
|---|---|
| PubChem CID | 139297111 |
| Molecular Formula | C45H33N5 |
| Molecular Weight | 643.79 g/mol |
| Exact Mass | 643.27 |
| IUPAC Name | 8-[4-[4-(4-phenylphenyl)-6-[(2E,4E)-5-quinolin-8-ylhexa-2,4-dien-2-yl]-1,3,5-triazin-2-yl]phenyl]quinoline |
| SMILES | C/C(=C\C=C(/C)c1cccc2cccnc12)c1nc(-c2ccc(-c3ccccc3)cc2)nc(-c2ccc(-c3cccc4cccnc34)cc2)n1 |
| InChI | InChI=1S/C45H33N5/c1-30(39-16-6-12-35-14-8-28-46-41(35)39)18-19-31(2)43-48-44(37-24-20-33(21-25-37)32-10-4-3-5-11-32)50-45(49-43)38-26-22-34(23-27-38)40-17-7-13-36-15-9-29-47-42(36)40/h3-29H,1-2H3/b30-18+,31-19+ |
| InChIKey | GYYJAZMORCWAMN-GFTXTJKWSA-N |
| XLogP | 11.14 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.79 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|