C58H42N4 — CID 130440101
2-[4-[8-[(2E,4E)-5-(4,6-diphenylpyrimidin-2-yl)hexa-2,4-dien-2-yl]phenanthren-1-yl]phenyl]-4,6-diphenylpyrimidine (PubChem CID 130440101) has the molecular formula C58H42N4 and a molecular weight of 795.00 g/mol. Its IUPAC name is 2-[4-[8-[(2E,4E)-5-(4,6-diphenylpyrimidin-2-yl)hexa-2,4-dien-2-yl]phenanthren-1-yl]phenyl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[4-[8-[(2E,4E)-5-(4,6-diphenylpyrimidin-2-yl)hexa-2,4-dien-2-yl]phenanthren-1-yl]phenyl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 130440101 |
| Molecular Formula | C58H42N4 |
| Molecular Weight | 795.00 g/mol |
| Exact Mass | 794.34 |
| IUPAC Name | 2-[4-[8-[(2E,4E)-5-(4,6-diphenylpyrimidin-2-yl)hexa-2,4-dien-2-yl]phenanthren-1-yl]phenyl]-4,6-diphenylpyrimidine |
| SMILES | C/C(=C\C=C(/C)c1cccc2c1ccc1c(-c3ccc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)cc3)cccc12)c1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C58H42N4/c1-39(29-30-40(2)57-59-53(42-17-7-3-8-18-42)37-54(60-57)43-19-9-4-10-20-43)47-25-15-27-49-50-28-16-26-48(52(50)36-35-51(47)49)41-31-33-46(34-32-41)58-61-55(44-21-11-5-12-22-44)38-56(62-58)45-23-13-6-14-24-45/h3-38H,1-2H3/b39-29+,40-30+ |
| InChIKey | IJFYKOSMEJFUGO-NXRKLTDKSA-N |
| XLogP | 15.08 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.00 |
| LogP ≤ 5 | 15.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|