C58H36N4 — CID 118074662
2-[4-[8-[4-(4-cyclohexa-1,5-dien-3-yn-1-yl-6-phenylpyrimidin-2-yl)phenyl]phenanthren-1-yl]phenyl]-4,6-diphenylpyrimidine (PubChem CID 118074662) has the molecular formula C58H36N4 and a molecular weight of 788.95 g/mol. Its IUPAC name is 2-[4-[8-[4-(4-cyclohexa-1,5-dien-3-yn-1-yl-6-phenylpyrimidin-2-yl)phenyl]phenanthren-1-yl]phenyl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[4-[8-[4-(4-cyclohexa-1,5-dien-3-yn-1-yl-6-phenylpyrimidin-2-yl)phenyl]phenanthren-1-yl]phenyl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 118074662 |
| Molecular Formula | C58H36N4 |
| Molecular Weight | 788.95 g/mol |
| Exact Mass | 788.29 |
| IUPAC Name | 2-[4-[8-[4-(4-cyclohexa-1,5-dien-3-yn-1-yl-6-phenylpyrimidin-2-yl)phenyl]phenanthren-1-yl]phenyl]-4,6-diphenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccc(-c4cccc5c4ccc4c(-c6ccc(-c7nc(-c8ccccc8)cc(-c8ccccc8)n7)cc6)cccc45)cc3)n2)cc#1 |
| InChI | InChI=1S/C58H36N4/c1-5-15-41(16-6-1)53-37-54(42-17-7-2-8-18-42)60-57(59-53)45-31-27-39(28-32-45)47-23-13-25-49-50-26-14-24-48(52(50)36-35-51(47)49)40-29-33-46(34-30-40)58-61-55(43-19-9-3-10-20-43)38-56(62-58)44-21-11-4-12-22-44/h1-3,5-11,13-38H |
| InChIKey | AAFSZATZWWBXPN-UHFFFAOYSA-N |
| XLogP | 14.51 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.95 |
| LogP ≤ 5 | 14.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|