C52H38N4 — CID 166739384
9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-phenylphenyl]phenyl]carbazole (PubChem CID 166739384) has the molecular formula C52H38N4 and a molecular weight of 718.90 g/mol. Its IUPAC name is 9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-phenylphenyl]phenyl]carbazole.
| Compound Name | 9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-phenylphenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 166739384 |
| Molecular Formula | C52H38N4 |
| Molecular Weight | 718.90 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | 9-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-[3-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-5-phenylphenyl]phenyl]carbazole |
| SMILES | C=C/C=C\C=C(/C)c1cc(-c2ccccc2)cc(-c2ccc(-n3c4ccccc4c4ccccc43)c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c1 |
| InChI | InChI=1S/C52H38N4/c1-3-4-8-19-36(2)41-32-42(37-20-9-5-10-21-37)34-43(33-41)40-30-31-49(56-47-28-17-15-26-44(47)45-27-16-18-29-48(45)56)46(35-40)52-54-50(38-22-11-6-12-23-38)53-51(55-52)39-24-13-7-14-25-39/h3-35H,1H2,2H3/b8-4-,36-19+ |
| InChIKey | JCLHQYIFKSYTMX-FBUYGAKDSA-N |
| XLogP | 13.45 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.90 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|