C75H52N4 — CID 155179728
9-[4-[4-[3-[(3Z)-hexa-1,3,5-trien-2-yl]-5-phenylphenyl]-6-phenyl-1,3,5-triazin-2-yl]-2,6-bis(4-phenylphenyl)phenyl]-3-phenylcarbazole (PubChem CID 155179728) has the molecular formula C75H52N4 and a molecular weight of 1009.27 g/mol. Its IUPAC name is 9-[4-[4-[3-[(3Z)-hexa-1,3,5-trien-2-yl]-5-phenylphenyl]-6-phenyl-1,3,5-triazin-2-yl]-2,6-bis(4-phenylphenyl)phenyl]-3-phenylcarbazole.
| Compound Name | 9-[4-[4-[3-[(3Z)-hexa-1,3,5-trien-2-yl]-5-phenylphenyl]-6-phenyl-1,3,5-triazin-2-yl]-2,6-bis(4-phenylphenyl)phenyl]-3-phenylcarbazole |
|---|---|
| PubChem CID | 155179728 |
| Molecular Formula | C75H52N4 |
| Molecular Weight | 1009.27 g/mol |
| Exact Mass | 1008.42 |
| IUPAC Name | 9-[4-[4-[3-[(3Z)-hexa-1,3,5-trien-2-yl]-5-phenylphenyl]-6-phenyl-1,3,5-triazin-2-yl]-2,6-bis(4-phenylphenyl)phenyl]-3-phenylcarbazole |
| SMILES | C=C/C=C\C(=C)c1cc(-c2ccccc2)cc(-c2nc(-c3ccccc3)nc(-c3cc(-c4ccc(-c5ccccc5)cc4)c(-n4c5ccccc5c5cc(-c6ccccc6)ccc54)c(-c4ccc(-c5ccccc5)cc4)c3)n2)c1 |
| InChI | InChI=1S/C75H52N4/c1-3-4-22-51(2)62-45-63(55-29-16-8-17-30-55)47-64(46-62)74-76-73(60-31-18-9-19-32-60)77-75(78-74)65-49-67(58-39-35-56(36-40-58)52-23-10-5-11-24-52)72(68(50-65)59-41-37-57(38-42-59)53-25-12-6-13-26-53)79-70-34-21-20-33-66(70)69-48-61(43-44-71(69)79)54-27-14-7-15-28-54/h3-50H,1-2H2/b22-4- |
| InChIKey | NNVJEEVMFAICFS-OZDWGKQUSA-N |
| XLogP | 19.73 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.27 |
| LogP ≤ 5 | 19.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|