C69H48N4 — CID 177276983
9-[4-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-2-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenylphenyl]-3,6-diphenylcarbazole (PubChem CID 177276983) has the molecular formula C69H48N4 and a molecular weight of 933.17 g/mol. Its IUPAC name is 9-[4-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-2-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenylphenyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[4-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-2-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenylphenyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 177276983 |
| Molecular Formula | C69H48N4 |
| Molecular Weight | 933.17 g/mol |
| Exact Mass | 932.39 |
| IUPAC Name | 9-[4-[4-(3,5-diphenylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-2-[(1E,3Z)-hexa-1,3,5-trienyl]-6-phenylphenyl]-3,6-diphenylcarbazole |
| SMILES | C=C/C=C\C=C\c1cc(-c2nc(-c3ccccc3)nc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)n2)cc(-c2ccccc2)c1-n1c2ccc(-c3ccccc3)cc2c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C69H48N4/c1-2-3-4-11-36-56-41-60(69-71-67(53-34-22-10-23-35-53)70-68(72-69)59-43-57(50-28-16-7-17-29-50)42-58(44-59)51-30-18-8-19-31-51)47-61(52-32-20-9-21-33-52)66(56)73-64-39-37-54(48-24-12-5-13-25-48)45-62(64)63-46-55(38-40-65(63)73)49-26-14-6-15-27-49/h2-47H,1H2/b4-3-,36-11+ |
| InChIKey | LTXWRXVPSFILNQ-ZPPDBIIWSA-N |
| XLogP | 18.06 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.17 |
| LogP ≤ 5 | 18.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|