C68H51N3O — CID 177277097
9-[2-[(1E,3E)-4-tert-butylhexa-1,3,5-trienyl]-4-(6-dibenzofuran-3-yl-2-phenylpyrimidin-4-yl)-6-phenylphenyl]-3,6-diphenylcarbazole (PubChem CID 177277097) has the molecular formula C68H51N3O and a molecular weight of 926.18 g/mol. Its IUPAC name is 9-[2-[(1E,3E)-4-tert-butylhexa-1,3,5-trienyl]-4-(6-dibenzofuran-3-yl-2-phenylpyrimidin-4-yl)-6-phenylphenyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[2-[(1E,3E)-4-tert-butylhexa-1,3,5-trienyl]-4-(6-dibenzofuran-3-yl-2-phenylpyrimidin-4-yl)-6-phenylphenyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 177277097 |
| Molecular Formula | C68H51N3O |
| Molecular Weight | 926.18 g/mol |
| Exact Mass | 925.40 |
| IUPAC Name | 9-[2-[(1E,3E)-4-tert-butylhexa-1,3,5-trienyl]-4-(6-dibenzofuran-3-yl-2-phenylpyrimidin-4-yl)-6-phenylphenyl]-3,6-diphenylcarbazole |
| SMILES | C=C/C(=C\C=C\c1cc(-c2cc(-c3ccc4c(c3)oc3ccccc34)nc(-c3ccccc3)n2)cc(-c2ccccc2)c1-n1c2ccc(-c3ccccc3)cc2c2cc(-c3ccccc3)ccc21)C(C)(C)C |
| InChI | InChI=1S/C68H51N3O/c1-5-54(68(2,3)4)30-20-29-52-39-53(61-44-60(69-67(70-61)48-27-16-9-17-28-48)51-33-36-56-55-31-18-19-32-64(55)72-65(56)43-51)42-57(47-25-14-8-15-26-47)66(52)71-62-37-34-49(45-21-10-6-11-22-45)40-58(62)59-41-50(35-38-63(59)71)46-23-12-7-13-24-46/h5-44H,1H2,2-4H3/b29-20+,54-30+ |
| InChIKey | YRBHBEJVWDHGJY-KRBPLQKGSA-N |
| XLogP | 18.65 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.18 |
| LogP ≤ 5 | 18.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|