C41H28N4 — CID 144787995
(12E)-12-benzylidene-11-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]indeno[2,1-a]carbazole (PubChem CID 144787995) has the molecular formula C41H28N4 and a molecular weight of 576.70 g/mol. Its IUPAC name is (12E)-12-benzylidene-11-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]indeno[2,1-a]carbazole.
| Compound Name | (12E)-12-benzylidene-11-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]indeno[2,1-a]carbazole |
|---|---|
| PubChem CID | 144787995 |
| Molecular Formula | C41H28N4 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | (12E)-12-benzylidene-11-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazin-2-yl]indeno[2,1-a]carbazole |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccccc2)nc(-n2c3ccccc3c3ccc4c(c32)/C(=C/c2ccccc2)c2ccccc2-4)n1 |
| InChI | InChI=1S/C41H28N4/c1-3-15-28(4-2)39-42-40(29-18-9-6-10-19-29)44-41(43-39)45-36-23-14-13-22-32(36)34-25-24-33-30-20-11-12-21-31(30)35(37(33)38(34)45)26-27-16-7-5-8-17-27/h3-26H,1-2H2/b28-15+,35-26+ |
| InChIKey | VLHXFWIGYXJFNL-LCYQPVSISA-N |
| XLogP | 9.96 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|