C42H28N6 — CID 144650033
12-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-quinolin-2-yl-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole (PubChem CID 144650033) has the molecular formula C42H28N6 and a molecular weight of 616.73 g/mol. Its IUPAC name is 12-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-quinolin-2-yl-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole.
| Compound Name | 12-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-quinolin-2-yl-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 144650033 |
| Molecular Formula | C42H28N6 |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | 12-[4-[(3E)-hexa-1,3,5-trien-3-yl]-6-quinolin-2-yl-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccc3ccccc3n2)nc(-n2c3ccccc3c3ccc4c5ccccc5n(-c5ccccc5)c4c32)n1 |
| InChI | InChI=1S/C42H28N6/c1-3-14-27(4-2)40-44-41(35-26-23-28-15-8-11-20-34(28)43-35)46-42(45-40)48-37-22-13-10-19-31(37)33-25-24-32-30-18-9-12-21-36(30)47(38(32)39(33)48)29-16-6-5-7-17-29/h3-26H,1-2H2/b27-14+ |
| InChIKey | XWQQPCRZUOUSIQ-MZJWZYIUSA-N |
| XLogP | 10.04 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|