C57H35N9 — CID 169037291
5-(4,6-diphenyl-1,3,5-triazin-2-yl)-12-[2-(4-phenyl-6-quinolin-2-yl-1,3,5-triazin-2-yl)phenyl]indolo[3,2-c]carbazole (PubChem CID 169037291) has the molecular formula C57H35N9 and a molecular weight of 845.97 g/mol. Its IUPAC name is 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-12-[2-(4-phenyl-6-quinolin-2-yl-1,3,5-triazin-2-yl)phenyl]indolo[3,2-c]carbazole.
| Compound Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-12-[2-(4-phenyl-6-quinolin-2-yl-1,3,5-triazin-2-yl)phenyl]indolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 169037291 |
| Molecular Formula | C57H35N9 |
| Molecular Weight | 845.97 g/mol |
| Exact Mass | 845.30 |
| IUPAC Name | 5-(4,6-diphenyl-1,3,5-triazin-2-yl)-12-[2-(4-phenyl-6-quinolin-2-yl-1,3,5-triazin-2-yl)phenyl]indolo[3,2-c]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccc4ccccc4n3)nc(-c3ccccc3-n3c4ccccc4c4ccc5c(c6ccccc6n5-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c43)n2)cc1 |
| InChI | InChI=1S/C57H35N9/c1-4-19-37(20-5-1)52-60-55(62-56(61-52)45-34-32-36-18-10-14-28-44(36)58-45)43-27-13-17-31-48(43)65-46-29-15-11-25-40(46)41-33-35-49-50(51(41)65)42-26-12-16-30-47(42)66(49)57-63-53(38-21-6-2-7-22-38)59-54(64-57)39-23-8-3-9-24-39/h1-35H |
| InChIKey | BQVLSOGWJZBRQR-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 100.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.97 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |