C60H38N8 — CID 169037460
12-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[2-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]indolo[3,2-c]carbazole (PubChem CID 169037460) has the molecular formula C60H38N8 and a molecular weight of 871.02 g/mol. Its IUPAC name is 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[2-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]indolo[3,2-c]carbazole.
| Compound Name | 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[2-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]indolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 169037460 |
| Molecular Formula | C60H38N8 |
| Molecular Weight | 871.02 g/mol |
| Exact Mass | 870.32 |
| IUPAC Name | 12-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[2-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]indolo[3,2-c]carbazole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4-n4c5ccccc5c5c4ccc4c6ccccc6n(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c45)n3)cc2)cc1 |
| InChI | InChI=1S/C60H38N8/c1-5-19-39(20-6-1)40-33-35-44(36-34-40)56-61-55(41-21-7-2-8-22-41)63-59(64-56)48-29-15-18-32-51(48)67-50-31-17-14-28-47(50)53-52(67)38-37-46-45-27-13-16-30-49(45)68(54(46)53)60-65-57(42-23-9-3-10-24-42)62-58(66-60)43-25-11-4-12-26-43/h1-38H |
| InChIKey | GTEOUJPUHUNUMU-UHFFFAOYSA-N |
| XLogP | 14.25 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.02 |
| LogP ≤ 5 | 14.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |