C58H40N4S — CID 167057938
2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-phenylphenyl)phenyl]-11-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-[1]benzothiolo[3,2-b]carbazole (PubChem CID 167057938) has the molecular formula C58H40N4S and a molecular weight of 825.05 g/mol. Its IUPAC name is 2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-phenylphenyl)phenyl]-11-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-[1]benzothiolo[3,2-b]carbazole.
| Compound Name | 2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-phenylphenyl)phenyl]-11-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-[1]benzothiolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 167057938 |
| Molecular Formula | C58H40N4S |
| Molecular Weight | 825.05 g/mol |
| Exact Mass | 824.30 |
| IUPAC Name | 2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4-(2-phenylphenyl)phenyl]-11-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-[1]benzothiolo[3,2-b]carbazole |
| SMILES | C=C/C=C\C=C(/C)n1c2ccccc2c2cc3sc4ccc(-c5ccc(-c6ccccc6-c6ccccc6)cc5-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4c3cc21 |
| InChI | InChI=1S/C58H40N4S/c1-3-4-8-19-38(2)62-52-29-18-17-28-47(52)48-37-55-50(36-53(48)62)49-34-43(31-33-54(49)63-55)46-32-30-42(45-27-16-15-26-44(45)39-20-9-5-10-21-39)35-51(46)58-60-56(40-22-11-6-12-23-40)59-57(61-58)41-24-13-7-14-25-41/h3-37H,1H2,2H3/b8-4-,38-19+ |
| InChIKey | OSFBPGRHJZXBCC-ACBVEVSBSA-N |
| XLogP | 15.95 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.05 |
| LogP ≤ 5 | 15.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|