C52H36N4S — CID 166736645
2-[3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]phenyl]-9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]carbazole (PubChem CID 166736645) has the molecular formula C52H36N4S and a molecular weight of 748.96 g/mol. Its IUPAC name is 2-[3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]phenyl]-9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]carbazole.
| Compound Name | 2-[3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]phenyl]-9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]carbazole |
|---|---|
| PubChem CID | 166736645 |
| Molecular Formula | C52H36N4S |
| Molecular Weight | 748.96 g/mol |
| Exact Mass | 748.27 |
| IUPAC Name | 2-[3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]phenyl]-9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]carbazole |
| SMILES | C=C/C=C\C=C(/C)n1c2ccccc2c2ccc(-c3cccc(-c4cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c5sc6ccccc6c5c4)c3)cc21 |
| InChI | InChI=1S/C52H36N4S/c1-3-4-7-17-34(2)56-46-26-14-12-24-41(46)42-29-28-39(33-47(42)56)37-22-16-23-38(30-37)40-31-44-43-25-13-15-27-48(43)57-49(44)45(32-40)52-54-50(35-18-8-5-9-19-35)53-51(55-52)36-20-10-6-11-21-36/h3-33H,1H2,2H3/b7-4-,34-17+ |
| InChIKey | PYLNEGPGBSONPI-XJFPEOTMSA-N |
| XLogP | 14.29 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.96 |
| LogP ≤ 5 | 14.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|