C32H28N2 — CID 89037399
9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methyl-N,N-diphenylcarbazol-4-amine (PubChem CID 89037399) has the molecular formula C32H28N2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methyl-N,N-diphenylcarbazol-4-amine.
| Compound Name | 9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methyl-N,N-diphenylcarbazol-4-amine |
|---|---|
| PubChem CID | 89037399 |
| Molecular Formula | C32H28N2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methyl-N,N-diphenylcarbazol-4-amine |
| SMILES | C=C/C=C\C=C(/C)n1c2ccccc2c2c(N(c3ccccc3)c3ccccc3)c(C)ccc21 |
| InChI | InChI=1S/C32H28N2/c1-4-5-8-15-25(3)33-29-21-14-13-20-28(29)31-30(33)23-22-24(2)32(31)34(26-16-9-6-10-17-26)27-18-11-7-12-19-27/h4-23H,1H2,2-3H3/b8-5-,25-15+ |
| InChIKey | IFVOWBFUJXCUNV-ORNZCJNGSA-N |
| XLogP | 9.18 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|