C18H23NO2 — CID 14066673
methyl 3-but-3-en-2-yl-2-butylindole-1-carboxylate (PubChem CID 14066673) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is methyl 3-but-3-en-2-yl-2-butylindole-1-carboxylate.
| Compound Name | methyl 3-but-3-en-2-yl-2-butylindole-1-carboxylate |
|---|---|
| PubChem CID | 14066673 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | methyl 3-but-3-en-2-yl-2-butylindole-1-carboxylate |
| SMILES | C=CC(C)c1c(CCCC)n(C(=O)OC)c2ccccc12 |
| InChI | InChI=1S/C18H23NO2/c1-5-7-11-16-17(13(3)6-2)14-10-8-9-12-15(14)19(16)18(20)21-4/h6,8-10,12-13H,2,5,7,11H2,1,3-4H3 |
| InChIKey | XKXROLUPNLLNKN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|