C29H33NO3 — CID 72702339
ethyl (2S,3S,4S)-3-acetyl-2-cyclohexyl-4-phenyl-1,2,3,4-tetrahydrocarbazole-9-carboxylate (PubChem CID 72702339) has the molecular formula C29H33NO3 and a molecular weight of 443.59 g/mol. Its IUPAC name is ethyl (2S,3S,4S)-3-acetyl-2-cyclohexyl-4-phenyl-1,2,3,4-tetrahydrocarbazole-9-carboxylate.
| Compound Name | ethyl (2S,3S,4S)-3-acetyl-2-cyclohexyl-4-phenyl-1,2,3,4-tetrahydrocarbazole-9-carboxylate |
|---|---|
| PubChem CID | 72702339 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | ethyl (2S,3S,4S)-3-acetyl-2-cyclohexyl-4-phenyl-1,2,3,4-tetrahydrocarbazole-9-carboxylate |
| SMILES | CCOC(=O)n1c2c(c3ccccc31)[C@H](c1ccccc1)[C@@H](C(C)=O)[C@H](C1CCCCC1)C2 |
| InChI | InChI=1S/C29H33NO3/c1-3-33-29(32)30-24-17-11-10-16-22(24)28-25(30)18-23(20-12-6-4-7-13-20)26(19(2)31)27(28)21-14-8-5-9-15-21/h5,8-11,14-17,20,23,26-27H,3-4,6-7,12-13,18H2,1-2H3/t23-,26-,27+/m0/s1 |
| InChIKey | PQVIDFWYVIMHMF-MSLLRLGPSA-N |
| XLogP | 6.74 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |