C17H20N2O2 — CID 102085932
methyl 1-methyl-2,3,3a,4,5,10c-hexahydropyrrolo[3,2-c]carbazole-6-carboxylate (PubChem CID 102085932) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is methyl 1-methyl-2,3,3a,4,5,10c-hexahydropyrrolo[3,2-c]carbazole-6-carboxylate.
| Compound Name | methyl 1-methyl-2,3,3a,4,5,10c-hexahydropyrrolo[3,2-c]carbazole-6-carboxylate |
|---|---|
| PubChem CID | 102085932 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | methyl 1-methyl-2,3,3a,4,5,10c-hexahydropyrrolo[3,2-c]carbazole-6-carboxylate |
| SMILES | COC(=O)n1c2c(c3ccccc31)C1C(CC2)CCN1C |
| InChI | InChI=1S/C17H20N2O2/c1-18-10-9-11-7-8-14-15(16(11)18)12-5-3-4-6-13(12)19(14)17(20)21-2/h3-6,11,16H,7-10H2,1-2H3 |
| InChIKey | VZRUWMIPPYTDFK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |