C22H33NO5 — CID 170747378
tert-butyl (1-methyl-2,3,3a,4,5,7a-hexahydroindol-6-yl) carbonate;1,2-dimethoxybenzene (PubChem CID 170747378) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is tert-butyl (1-methyl-2,3,3a,4,5,7a-hexahydroindol-6-yl) carbonate;1,2-dimethoxybenzene.
| Compound Name | tert-butyl (1-methyl-2,3,3a,4,5,7a-hexahydroindol-6-yl) carbonate;1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 170747378 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | tert-butyl (1-methyl-2,3,3a,4,5,7a-hexahydroindol-6-yl) carbonate;1,2-dimethoxybenzene |
| SMILES | CN1CCC2CCC(OC(=O)OC(C)(C)C)=CC21.COc1ccccc1OC |
| InChI | InChI=1S/C14H23NO3.C8H10O2/c1-14(2,3)18-13(16)17-11-6-5-10-7-8-15(4)12(10)9-11;1-9-7-5-3-4-6-8(7)10-2/h9-10,12H,5-8H2,1-4H3;3-6H,1-2H3 |
| InChIKey | QSUHRENIZGGMEY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |