C20H31NO3 — CID 171567506
1,2-dimethoxybenzene;7-ethyl-1,7-dimethyl-2,3,3a,4,5,7a-hexahydroindol-6-one (PubChem CID 171567506) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is 1,2-dimethoxybenzene;7-ethyl-1,7-dimethyl-2,3,3a,4,5,7a-hexahydroindol-6-one.
| Compound Name | 1,2-dimethoxybenzene;7-ethyl-1,7-dimethyl-2,3,3a,4,5,7a-hexahydroindol-6-one |
|---|---|
| PubChem CID | 171567506 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 1,2-dimethoxybenzene;7-ethyl-1,7-dimethyl-2,3,3a,4,5,7a-hexahydroindol-6-one |
| SMILES | CCC1(C)C(=O)CCC2CCN(C)C21.COc1ccccc1OC |
| InChI | InChI=1S/C12H21NO.C8H10O2/c1-4-12(2)10(14)6-5-9-7-8-13(3)11(9)12;1-9-7-5-3-4-6-8(7)10-2/h9,11H,4-8H2,1-3H3;3-6H,1-2H3 |
| InChIKey | FVZNRZCEBGIXQD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |