C20H30N2O4 — CID 170747098
1,2-dimethoxybenzene;(1-methyl-2,3,3a,4,5,7a-hexahydroindol-6-yl) N,N-dimethylcarbamate (PubChem CID 170747098) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1,2-dimethoxybenzene;(1-methyl-2,3,3a,4,5,7a-hexahydroindol-6-yl) N,N-dimethylcarbamate.
| Compound Name | 1,2-dimethoxybenzene;(1-methyl-2,3,3a,4,5,7a-hexahydroindol-6-yl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 170747098 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 1,2-dimethoxybenzene;(1-methyl-2,3,3a,4,5,7a-hexahydroindol-6-yl) N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OC1=CC2C(CC1)CCN2C.COc1ccccc1OC |
| InChI | InChI=1S/C12H20N2O2.C8H10O2/c1-13(2)12(15)16-10-5-4-9-6-7-14(3)11(9)8-10;1-9-7-5-3-4-6-8(7)10-2/h8-9,11H,4-7H2,1-3H3;3-6H,1-2H3 |
| InChIKey | KLDIPGVCBWGEDB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |