C26H36N2O4 — CID 170747362
1,2-dimethoxybenzene;methane;(1-methyl-2,3,3a,4,7,7a-hexahydroindol-6-yl) N-methyl-N-phenylcarbamate (PubChem CID 170747362) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is 1,2-dimethoxybenzene;methane;(1-methyl-2,3,3a,4,7,7a-hexahydroindol-6-yl) N-methyl-N-phenylcarbamate.
| Compound Name | 1,2-dimethoxybenzene;methane;(1-methyl-2,3,3a,4,7,7a-hexahydroindol-6-yl) N-methyl-N-phenylcarbamate |
|---|---|
| PubChem CID | 170747362 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 1,2-dimethoxybenzene;methane;(1-methyl-2,3,3a,4,7,7a-hexahydroindol-6-yl) N-methyl-N-phenylcarbamate |
| SMILES | C.CN(C(=O)OC1=CCC2CCN(C)C2C1)c1ccccc1.COc1ccccc1OC |
| InChI | InChI=1S/C17H22N2O2.C8H10O2.CH4/c1-18-11-10-13-8-9-15(12-16(13)18)21-17(20)19(2)14-6-4-3-5-7-14;1-9-7-5-3-4-6-8(7)10-2;/h3-7,9,13,16H,8,10-12H2,1-2H3;3-6H,1-2H3;1H4 |
| InChIKey | WVHISTUIXQTGFJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |