C17H23NO4 — CID 171567428
1,2-dimethoxybenzene;4-methyl-3,3a,5,6,6a,6b-hexahydro-1aH-oxireno[2,3-e]indol-2-one (PubChem CID 171567428) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 1,2-dimethoxybenzene;4-methyl-3,3a,5,6,6a,6b-hexahydro-1aH-oxireno[2,3-e]indol-2-one.
| Compound Name | 1,2-dimethoxybenzene;4-methyl-3,3a,5,6,6a,6b-hexahydro-1aH-oxireno[2,3-e]indol-2-one |
|---|---|
| PubChem CID | 171567428 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 1,2-dimethoxybenzene;4-methyl-3,3a,5,6,6a,6b-hexahydro-1aH-oxireno[2,3-e]indol-2-one |
| SMILES | CN1CCC2C3OC3C(=O)CC21.COc1ccccc1OC |
| InChI | InChI=1S/C9H13NO2.C8H10O2/c1-10-3-2-5-6(10)4-7(11)9-8(5)12-9;1-9-7-5-3-4-6-8(7)10-2/h5-6,8-9H,2-4H2,1H3;3-6H,1-2H3 |
| InChIKey | HWMREPHGIJNDGK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|