C16H22N2O5S — CID 133125406
1-[(4aS,7aR)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-(2-methoxyphenoxy)ethanone (PubChem CID 133125406) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is 1-[(4aS,7aR)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-(2-methoxyphenoxy)ethanone.
| Compound Name | 1-[(4aS,7aR)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-(2-methoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 133125406 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-[(4aS,7aR)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-2-(2-methoxyphenoxy)ethanone |
| SMILES | COc1ccccc1OCC(=O)N1CCN(C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H22N2O5S/c1-17-7-8-18(13-11-24(20,21)10-12(13)17)16(19)9-23-15-6-4-3-5-14(15)22-2/h3-6,12-13H,7-11H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | YPCPXLKCLYAHOX-QWHCGFSZSA-N |
| XLogP | 0.01 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |