C20H22N2O3S — CID 70712706
[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-phenylphenyl)methanone (PubChem CID 70712706) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is [(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-phenylphenyl)methanone.
| Compound Name | [(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-phenylphenyl)methanone |
|---|---|
| PubChem CID | 70712706 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-phenylphenyl)methanone |
| SMILES | CN1CCN(C(=O)c2ccccc2-c2ccccc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C20H22N2O3S/c1-21-11-12-22(19-14-26(24,25)13-18(19)21)20(23)17-10-6-5-9-16(17)15-7-3-2-4-8-15/h2-10,18-19H,11-14H2,1H3/t18-,19+/m1/s1 |
| InChIKey | JZUZQPHOVBRHDW-MOPGFXCFSA-N |
| XLogP | 1.91 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |