C16H22N2O4S — CID 133129472
[(4aS,7aR)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-ethoxyphenyl)methanone (PubChem CID 133129472) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is [(4aS,7aR)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-ethoxyphenyl)methanone.
| Compound Name | [(4aS,7aR)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 133129472 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | [(4aS,7aR)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-ethoxyphenyl)methanone |
| SMILES | CCOc1ccccc1C(=O)N1CCN(C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H22N2O4S/c1-3-22-15-7-5-4-6-12(15)16(19)18-9-8-17(2)13-10-23(20,21)11-14(13)18/h4-7,13-14H,3,8-11H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | JBDWFIRELUGMRD-UONOGXRCSA-N |
| XLogP | 0.64 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |