C17H25N3O4S — CID 70773007
3-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-6-ethyl-1,5-dimethylpyridin-2-one (PubChem CID 70773007) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is 3-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-6-ethyl-1,5-dimethylpyridin-2-one.
| Compound Name | 3-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-6-ethyl-1,5-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 70773007 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 3-[(4aR,7aS)-1-methyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-6-ethyl-1,5-dimethylpyridin-2-one |
| SMILES | CCc1c(C)cc(C(=O)N2CCN(C)[C@@H]3CS(=O)(=O)C[C@@H]32)c(=O)n1C |
| InChI | InChI=1S/C17H25N3O4S/c1-5-13-11(2)8-12(16(21)19(13)4)17(22)20-7-6-18(3)14-9-25(23,24)10-15(14)20/h8,14-15H,5-7,9-10H2,1-4H3/t14-,15+/m1/s1 |
| InChIKey | DJWCVKLCPSXXAA-CABCVRRESA-N |
| XLogP | -0.19 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |