C17H23N3O5S — CID 70761854
3-[(4aR,7aS)-1-acetyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-1-ethyl-6-methylpyridin-2-one (PubChem CID 70761854) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is 3-[(4aR,7aS)-1-acetyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-1-ethyl-6-methylpyridin-2-one.
| Compound Name | 3-[(4aR,7aS)-1-acetyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-1-ethyl-6-methylpyridin-2-one |
|---|---|
| PubChem CID | 70761854 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 3-[(4aR,7aS)-1-acetyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-1-ethyl-6-methylpyridin-2-one |
| SMILES | CCn1c(C)ccc(C(=O)N2CCN(C(C)=O)[C@@H]3CS(=O)(=O)C[C@@H]32)c1=O |
| InChI | InChI=1S/C17H23N3O5S/c1-4-18-11(2)5-6-13(16(18)22)17(23)20-8-7-19(12(3)21)14-9-26(24,25)10-15(14)20/h5-6,14-15H,4,7-10H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | MGPHUJRABZHSIL-CABCVRRESA-N |
| XLogP | -0.35 |
| TPSA | 96.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |