C14H18N4O4S — CID 133131858
1-[(4aS,7aR)-4-(5-methylpyrazine-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanone (PubChem CID 133131858) has the molecular formula C14H18N4O4S and a molecular weight of 338.39 g/mol. Its IUPAC name is 1-[(4aS,7aR)-4-(5-methylpyrazine-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanone.
| Compound Name | 1-[(4aS,7aR)-4-(5-methylpyrazine-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanone |
|---|---|
| PubChem CID | 133131858 |
| Molecular Formula | C14H18N4O4S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-[(4aS,7aR)-4-(5-methylpyrazine-2-carbonyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2cnc(C)cn2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C14H18N4O4S/c1-9-5-16-11(6-15-9)14(20)18-4-3-17(10(2)19)12-7-23(21,22)8-13(12)18/h5-6,12-13H,3-4,7-8H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | MGJZBEKRQCUDGI-QWHCGFSZSA-N |
| XLogP | -0.75 |
| TPSA | 100.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |